C21H24N2O3 — CID 91770642
4-[(3S,4R)-4-(2,3-dihydro-1H-inden-2-ylamino)oxan-3-yl]oxybenzamide (PubChem CID 91770642) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-[(3S,4R)-4-(2,3-dihydro-1H-inden-2-ylamino)oxan-3-yl]oxybenzamide.
| Compound Name | 4-[(3S,4R)-4-(2,3-dihydro-1H-inden-2-ylamino)oxan-3-yl]oxybenzamide |
|---|---|
| PubChem CID | 91770642 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-[(3S,4R)-4-(2,3-dihydro-1H-inden-2-ylamino)oxan-3-yl]oxybenzamide |
| SMILES | NC(=O)c1ccc(O[C@@H]2COCC[C@H]2NC2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C21H24N2O3/c22-21(24)14-5-7-18(8-6-14)26-20-13-25-10-9-19(20)23-17-11-15-3-1-2-4-16(15)12-17/h1-8,17,19-20,23H,9-13H2,(H2,22,24)/t19-,20-/m1/s1 |
| InChIKey | PFNUIGNEPSNVPY-WOJBJXKFSA-N |
| XLogP | 2.08 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |