C15H23N3O2 — CID 91772201
trans-(1S,3S)-3-hydroxy-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]cyclohexane-1-carboxamide (PubChem CID 91772201) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is trans-(1S,3S)-3-hydroxy-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1S,3S)-3-hydroxy-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91772201 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | trans-(1S,3S)-3-hydroxy-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]cyclohexane-1-carboxamide |
| SMILES | Cc1cnccc1NCCNC(=O)[C@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C15H23N3O2/c1-11-10-16-6-5-14(11)17-7-8-18-15(20)12-3-2-4-13(19)9-12/h5-6,10,12-13,19H,2-4,7-9H2,1H3,(H,16,17)(H,18,20)/t12-,13-/m0/s1 |
| InChIKey | YOOUGEYIVWATGP-STQMWFEESA-N |
| XLogP | 1.47 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|