About 2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid
2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid (PubChem CID 91772656) has the molecular formula C11H15ClN4O5
and a molecular weight of 318.72 g/mol. Its IUPAC name is 2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid |
| PubChem CID | 91772656 |
| Molecular Formula | C11H15ClN4O5 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid |
| SMILES | Nc1n[nH]c(C(=O)N[C@@H]2CCOC[C@H]2OCC(=O)O)c1Cl |
| InChI | InChI=1S/C11H15ClN4O5/c12-8-9(15-16-10(8)13)11(19)14-5-1-2-20-3-6(5)21-4-7(17)18/h5-6H,1-4H2,(H,14,19)(H,17,18)(H3,13,15,16)/t5-,6-/m1/s1 |
| InChIKey | UBGHGDBPHFWILA-PHDIDXHHSA-N |
| XLogP | -0.37 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid?
The IUPAC name of 2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid (CID 91772656) is 2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid.
What is the SMILES notation for 2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid?
The canonical SMILES for 2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid is Nc1n[nH]c(C(=O)N[C@@H]2CCOC[C@H]2OCC(=O)O)c1Cl.
What is the InChIKey of 2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid?
The InChIKey is UBGHGDBPHFWILA-PHDIDXHHSA-N. The full InChI is InChI=1S/C11H15ClN4O5/c12-8-9(15-16-10(8)13)11(19)14-5-1-2-20-3-6(5)21-4-7(17)18/h5-6H,1-4H2,(H,14,19)(H,17,18)(H3,13,15,16)/t5-,6-/m1/s1.
What are the key properties of 2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid?
2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid has a molecular weight of 318.72 g/mol, XLogP of -0.37, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-4-[(3-amino-4-chloro-1H-pyrazole-5-carbonyl)amino]oxan-3-yl]oxyacetic acid is sourced from PubChem (CID 91772656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).