C19H32N4O2 — CID 91774284
N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide (PubChem CID 91774284) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide.
| Compound Name | N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide |
|---|---|
| PubChem CID | 91774284 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide |
| SMILES | CCn1ccnc1CN(C)C(=O)CCC(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C19H32N4O2/c1-3-23-14-13-20-17(23)15-22(2)19(25)12-11-18(24)21-16-9-7-5-4-6-8-10-16/h13-14,16H,3-12,15H2,1-2H3,(H,21,24) |
| InChIKey | PKOMEDLULFSBGT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |