About N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide
N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide (PubChem CID 91774284) has the molecular formula C19H32N4O2
and a molecular weight of 348.49 g/mol. Its IUPAC name is N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide.
Molecular Properties
| Compound Name | N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide |
| PubChem CID | 91774284 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide |
| SMILES | CCn1ccnc1CN(C)C(=O)CCC(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C19H32N4O2/c1-3-23-14-13-20-17(23)15-22(2)19(25)12-11-18(24)21-16-9-7-5-4-6-8-10-16/h13-14,16H,3-12,15H2,1-2H3,(H,21,24) |
| InChIKey | PKOMEDLULFSBGT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide?
The IUPAC name of N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide (CID 91774284) is N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide.
What is the SMILES notation for N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide?
The canonical SMILES for N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide is CCn1ccnc1CN(C)C(=O)CCC(=O)NC1CCCCCCC1.
What is the InChIKey of N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide?
The InChIKey is PKOMEDLULFSBGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N4O2/c1-3-23-14-13-20-17(23)15-22(2)19(25)12-11-18(24)21-16-9-7-5-4-6-8-10-16/h13-14,16H,3-12,15H2,1-2H3,(H,21,24).
What are the key properties of N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide?
N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide has a molecular weight of 348.49 g/mol, XLogP of 2.87, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclooctyl-N'-[(1-ethylimidazol-2-yl)methyl]-N'-methylbutanediamide is sourced from PubChem (CID 91774284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).