C16H22ClNO3 — CID 91774896
trans-(1S,3S)-N-[2-[(4-chlorophenyl)methoxy]ethyl]-3-hydroxycyclohexane-1-carboxamide (PubChem CID 91774896) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is trans-(1S,3S)-N-[2-[(4-chlorophenyl)methoxy]ethyl]-3-hydroxycyclohexane-1-carboxamide.
| Compound Name | trans-(1S,3S)-N-[2-[(4-chlorophenyl)methoxy]ethyl]-3-hydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91774896 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | trans-(1S,3S)-N-[2-[(4-chlorophenyl)methoxy]ethyl]-3-hydroxycyclohexane-1-carboxamide |
| SMILES | O=C(NCCOCc1ccc(Cl)cc1)[C@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C16H22ClNO3/c17-14-6-4-12(5-7-14)11-21-9-8-18-16(20)13-2-1-3-15(19)10-13/h4-7,13,15,19H,1-3,8-11H2,(H,18,20)/t13-,15-/m0/s1 |
| InChIKey | QXCIXDSIXFTONL-ZFWWWQNUSA-N |
| XLogP | 2.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|