C20H24N2O3S — CID 91776302
N-[(3-hydroxycyclobutyl)-thiophen-2-ylmethyl]-4-morpholin-4-ylbenzamide (PubChem CID 91776302) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)-thiophen-2-ylmethyl]-4-morpholin-4-ylbenzamide.
| Compound Name | N-[(3-hydroxycyclobutyl)-thiophen-2-ylmethyl]-4-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 91776302 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)-thiophen-2-ylmethyl]-4-morpholin-4-ylbenzamide |
| SMILES | O=C(NC(c1cccs1)C1CC(O)C1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c23-17-12-15(13-17)19(18-2-1-11-26-18)21-20(24)14-3-5-16(6-4-14)22-7-9-25-10-8-22/h1-6,11,15,17,19,23H,7-10,12-13H2,(H,21,24) |
| InChIKey | LUJVKDIVWJMRBA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |