C19H17NO4S — CID 91778738
N-[(3-hydroxycyclobutyl)-thiophen-2-ylmethyl]-4-oxochromene-2-carboxamide (PubChem CID 91778738) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)-thiophen-2-ylmethyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[(3-hydroxycyclobutyl)-thiophen-2-ylmethyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 91778738 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)-thiophen-2-ylmethyl]-4-oxochromene-2-carboxamide |
| SMILES | O=C(NC(c1cccs1)C1CC(O)C1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C19H17NO4S/c21-12-8-11(9-12)18(17-6-3-7-25-17)20-19(23)16-10-14(22)13-4-1-2-5-15(13)24-16/h1-7,10-12,18,21H,8-9H2,(H,20,23) |
| InChIKey | MQHYYULKPFDMEC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |