C16H20N2O2S — CID 91778652
(3S,4S)-4-ethoxy-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]pyrrolidin-3-ol (PubChem CID 91778652) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is (3S,4S)-4-ethoxy-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]pyrrolidin-3-ol.
| Compound Name | (3S,4S)-4-ethoxy-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 91778652 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (3S,4S)-4-ethoxy-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]pyrrolidin-3-ol |
| SMILES | CCO[C@H]1CN(Cc2nc(-c3ccccc3)cs2)C[C@@H]1O |
| InChI | InChI=1S/C16H20N2O2S/c1-2-20-15-9-18(8-14(15)19)10-16-17-13(11-21-16)12-6-4-3-5-7-12/h3-7,11,14-15,19H,2,8-10H2,1H3/t14-,15-/m0/s1 |
| InChIKey | FBBKKTMQTAIFSX-GJZGRUSLSA-N |
| XLogP | 2.39 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |