C15H24N4O4 — CID 91779674
2-(2-ethoxyethyl)-5-methyl-N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]pyrazole-3-carboxamide (PubChem CID 91779674) has the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-5-methyl-N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]pyrazole-3-carboxamide.
| Compound Name | 2-(2-ethoxyethyl)-5-methyl-N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 91779674 |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-(2-ethoxyethyl)-5-methyl-N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]pyrazole-3-carboxamide |
| SMILES | CCOCCn1nc(C)cc1C(=O)NCCN1CCCOC1=O |
| InChI | InChI=1S/C15H24N4O4/c1-3-22-10-8-19-13(11-12(2)17-19)14(20)16-5-7-18-6-4-9-23-15(18)21/h11H,3-10H2,1-2H3,(H,16,20) |
| InChIKey | HXQLWPOEBRAWQA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|