About 4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide
4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide (PubChem CID 91784110) has the molecular formula C22H24FN3O
and a molecular weight of 365.45 g/mol. Its IUPAC name is 4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide.
Molecular Properties
| Compound Name | 4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide |
| PubChem CID | 91784110 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide |
| SMILES | CN(Cc1cc2cc(F)ccc2[nH]1)C(=O)CCCN1Cc2ccccc2C1 |
| InChI | InChI=1S/C22H24FN3O/c1-25(15-20-12-18-11-19(23)8-9-21(18)24-20)22(27)7-4-10-26-13-16-5-2-3-6-17(16)14-26/h2-3,5-6,8-9,11-12,24H,4,7,10,13-15H2,1H3 |
| InChIKey | IWDNRGUFUPNHIT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide?
The IUPAC name of 4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide (CID 91784110) is 4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide.
What is the SMILES notation for 4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide?
The canonical SMILES for 4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide is CN(Cc1cc2cc(F)ccc2[nH]1)C(=O)CCCN1Cc2ccccc2C1.
What is the InChIKey of 4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide?
The InChIKey is IWDNRGUFUPNHIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24FN3O/c1-25(15-20-12-18-11-19(23)8-9-21(18)24-20)22(27)7-4-10-26-13-16-5-2-3-6-17(16)14-26/h2-3,5-6,8-9,11-12,24H,4,7,10,13-15H2,1H3.
What are the key properties of 4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide?
4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide has a molecular weight of 365.45 g/mol, XLogP of 4.06, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dihydroisoindol-2-yl)-N-[(5-fluoro-1H-indol-2-yl)methyl]-N-methylbutanamide is sourced from PubChem (CID 91784110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).