C12H18N4O4 — CID 91793872
6-[[(3R,4S)-4-(2-hydroxyethoxy)oxan-3-yl]amino]pyrazine-2-carboxamide (PubChem CID 91793872) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 6-[[(3R,4S)-4-(2-hydroxyethoxy)oxan-3-yl]amino]pyrazine-2-carboxamide.
| Compound Name | 6-[[(3R,4S)-4-(2-hydroxyethoxy)oxan-3-yl]amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 91793872 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 6-[[(3R,4S)-4-(2-hydroxyethoxy)oxan-3-yl]amino]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1cncc(N[C@@H]2COCC[C@@H]2OCCO)n1 |
| InChI | InChI=1S/C12H18N4O4/c13-12(18)8-5-14-6-11(15-8)16-9-7-19-3-1-10(9)20-4-2-17/h5-6,9-10,17H,1-4,7H2,(H2,13,18)(H,15,16)/t9-,10+/m1/s1 |
| InChIKey | KUWOSDFUWHHBRL-ZJUUUORDSA-N |
| XLogP | -0.85 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |