C17H31N3O5 — CID 177015216
5-[(3,4-dihydroxyoxan-2-yl)methylamino]pyrazine-2-carbaldehyde;ethane;2-methoxypropane (PubChem CID 177015216) has the molecular formula C17H31N3O5 and a molecular weight of 357.45 g/mol. Its IUPAC name is 5-[(3,4-dihydroxyoxan-2-yl)methylamino]pyrazine-2-carbaldehyde;ethane;2-methoxypropane.
| Compound Name | 5-[(3,4-dihydroxyoxan-2-yl)methylamino]pyrazine-2-carbaldehyde;ethane;2-methoxypropane |
|---|---|
| PubChem CID | 177015216 |
| Molecular Formula | C17H31N3O5 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 5-[(3,4-dihydroxyoxan-2-yl)methylamino]pyrazine-2-carbaldehyde;ethane;2-methoxypropane |
| SMILES | CC.COC(C)C.O=Cc1cnc(NCC2OCCC(O)C2O)cn1 |
| InChI | InChI=1S/C11H15N3O4.C4H10O.C2H6/c15-6-7-3-13-10(5-12-7)14-4-9-11(17)8(16)1-2-18-9;1-4(2)5-3;1-2/h3,5-6,8-9,11,16-17H,1-2,4H2,(H,13,14);4H,1-3H3;1-2H3 |
| InChIKey | UUAXPNIPLXTJAB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|