C19H13ClN4O2 — CID 91795068
N-[[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methyl]quinoxaline-2-carboxamide (PubChem CID 91795068) has the molecular formula C19H13ClN4O2 and a molecular weight of 364.79 g/mol. Its IUPAC name is N-[[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 91795068 |
| Molecular Formula | C19H13ClN4O2 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-[[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methyl]quinoxaline-2-carboxamide |
| SMILES | O=C(NCc1cc(-c2cccc(Cl)c2)no1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C19H13ClN4O2/c20-13-5-3-4-12(8-13)17-9-14(26-24-17)10-22-19(25)18-11-21-15-6-1-2-7-16(15)23-18/h1-9,11H,10H2,(H,22,25) |
| InChIKey | SLTZEOPNBVHSTR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |