C12H16ClNO4S — CID 91796047
3-chloro-N-[(3R,4R)-4-hydroxyoxan-3-yl]-4-methylbenzenesulfonamide (PubChem CID 91796047) has the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. Its IUPAC name is 3-chloro-N-[(3R,4R)-4-hydroxyoxan-3-yl]-4-methylbenzenesulfonamide.
| Compound Name | 3-chloro-N-[(3R,4R)-4-hydroxyoxan-3-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 91796047 |
| Molecular Formula | C12H16ClNO4S |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 3-chloro-N-[(3R,4R)-4-hydroxyoxan-3-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2COCC[C@H]2O)cc1Cl |
| InChI | InChI=1S/C12H16ClNO4S/c1-8-2-3-9(6-10(8)13)19(16,17)14-11-7-18-5-4-12(11)15/h2-3,6,11-12,14-15H,4-5,7H2,1H3/t11-,12-/m1/s1 |
| InChIKey | VKASZJNEFRHEGT-VXGBXAGGSA-N |
| XLogP | 1.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |