C16H21N3O3 — CID 91796498
1-[2-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-oxoethyl]-5-methylpyrimidine-2,4-dione (PubChem CID 91796498) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-[2-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-oxoethyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[2-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-oxoethyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91796498 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[2-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-oxoethyl]-5-methylpyrimidine-2,4-dione |
| SMILES | CC1=CC[C@@H]2CN(C(=O)Cn3cc(C)c(=O)[nH]c3=O)C[C@@H]2C1 |
| InChI | InChI=1S/C16H21N3O3/c1-10-3-4-12-7-18(8-13(12)5-10)14(20)9-19-6-11(2)15(21)17-16(19)22/h3,6,12-13H,4-5,7-9H2,1-2H3,(H,17,21,22)/t12-,13+/m1/s1 |
| InChIKey | ACJYENPGXNZODX-OLZOCXBDSA-N |
| XLogP | 0.66 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|