C10H11F3I2O3SSi — CID 91801290
(4,5-diiodo-2-trimethylsilylphenyl) trifluoromethanesulfonate (PubChem CID 91801290) has the molecular formula C10H11F3I2O3SSi and a molecular weight of 550.15 g/mol. Its IUPAC name is (4,5-diiodo-2-trimethylsilylphenyl) trifluoromethanesulfonate.
| Compound Name | (4,5-diiodo-2-trimethylsilylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91801290 |
| Molecular Formula | C10H11F3I2O3SSi |
| Molecular Weight | 550.15 g/mol |
| Exact Mass | 549.82 |
| IUPAC Name | (4,5-diiodo-2-trimethylsilylphenyl) trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)c1cc(I)c(I)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H11F3I2O3SSi/c1-20(2,3)9-5-7(15)6(14)4-8(9)18-19(16,17)10(11,12)13/h4-5H,1-3H3 |
| InChIKey | CMOXOANTLMFRSC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|