C6H9N3 — CID 91801683
3,5,6,7-tetrahydrotriazolo[1,5-a]pyridine (PubChem CID 91801683) has the molecular formula C6H9N3 and a molecular weight of 123.16 g/mol. Its IUPAC name is 3,5,6,7-tetrahydrotriazolo[1,5-a]pyridine.
| Compound Name | 3,5,6,7-tetrahydrotriazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 91801683 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 3,5,6,7-tetrahydrotriazolo[1,5-a]pyridine |
| SMILES | C1=C2CN=NN2CCC1 |
| InChI | InChI=1S/C6H9N3/c1-2-4-9-6(3-1)5-7-8-9/h3H,1-2,4-5H2 |
| InChIKey | GBFHIKBMORSFEK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |