C10H15N3 — CID 165130769
1-butan-2-yl-5,6-dihydrobenzotriazole (PubChem CID 165130769) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-butan-2-yl-5,6-dihydrobenzotriazole.
| Compound Name | 1-butan-2-yl-5,6-dihydrobenzotriazole |
|---|---|
| PubChem CID | 165130769 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-butan-2-yl-5,6-dihydrobenzotriazole |
| SMILES | CCC(C)n1nnc2c1=CCCC=2 |
| InChI | InChI=1S/C10H15N3/c1-3-8(2)13-10-7-5-4-6-9(10)11-12-13/h6-8H,3-5H2,1-2H3 |
| InChIKey | CGUKZPYTOYNJPB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |