C10H11N — CID 91801934
2-buta-1,2-dienyl-6-methylpyridine (PubChem CID 91801934) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-buta-1,2-dienyl-6-methylpyridine.
| Compound Name | 2-buta-1,2-dienyl-6-methylpyridine |
|---|---|
| PubChem CID | 91801934 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2-buta-1,2-dienyl-6-methylpyridine |
| SMILES | CC=C=Cc1cccc(C)n1 |
| InChI | InChI=1S/C10H11N/c1-3-4-7-10-8-5-6-9(2)11-10/h3,5-8H,1-2H3 |
| InChIKey | JEMMNNBOCLQDMN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |