C14H24N+ — CID 91802179
5-ethyl-1,2,3,4-tetramethyl-6-propan-2-ylpyridin-1-ium (PubChem CID 91802179) has the molecular formula C14H24N+ and a molecular weight of 206.35 g/mol. Its IUPAC name is 5-ethyl-1,2,3,4-tetramethyl-6-propan-2-ylpyridin-1-ium.
| Compound Name | 5-ethyl-1,2,3,4-tetramethyl-6-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 91802179 |
| Molecular Formula | C14H24N+ |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.19 |
| IUPAC Name | 5-ethyl-1,2,3,4-tetramethyl-6-propan-2-ylpyridin-1-ium |
| SMILES | CCc1c(C)c(C)c(C)[n+](C)c1C(C)C |
| InChI | InChI=1S/C14H24N/c1-8-13-11(5)10(4)12(6)15(7)14(13)9(2)3/h9H,8H2,1-7H3/q+1 |
| InChIKey | ASPHTGVFYSGCJK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|