C35H20N2O2S2+2 — CID 91804214
11,11'-spirobi[12-oxa-3-thia-10-azoniapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1(13),2(10),4,6,8,14,16,18,20-nonaene] (PubChem CID 91804214) has the molecular formula C35H20N2O2S2+2 and a molecular weight of 564.69 g/mol. Its IUPAC name is 11,11'-spirobi[12-oxa-3-thia-10-azoniapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1(13),2(10),4,6,8,14,16,18,20-nonaene].
| Compound Name | 11,11'-spirobi[12-oxa-3-thia-10-azoniapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1(13),2(10),4,6,8,14,16,18,20-nonaene] |
|---|---|
| PubChem CID | 91804214 |
| Molecular Formula | C35H20N2O2S2+2 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | 11,11'-spirobi[12-oxa-3-thia-10-azoniapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1(13),2(10),4,6,8,14,16,18,20-nonaene] |
| SMILES | c1ccc2c3c(ccc2c1)-c1sc2ccccc2[n+]1C1(O3)Oc2c(ccc3ccccc23)-c2sc3ccccc3[n+]21 |
| InChI | InChI=1S/C35H20N2O2S2/c1-3-11-23-21(9-1)17-19-25-31(23)38-35(36-27-13-5-7-15-29(27)40-33(25)36)37-28-14-6-8-16-30(28)41-34(37)26-20-18-22-10-2-4-12-24(22)32(26)39-35/h1-20H/q+2 |
| InChIKey | CTZZCKFZKHTXEC-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|