C6H9I2O3S- — CID 91805576
(2,4-diiodocyclohexyl) sulfite (PubChem CID 91805576) has the molecular formula C6H9I2O3S- and a molecular weight of 415.01 g/mol. Its IUPAC name is (2,4-diiodocyclohexyl) sulfite.
| Compound Name | (2,4-diiodocyclohexyl) sulfite |
|---|---|
| PubChem CID | 91805576 |
| Molecular Formula | C6H9I2O3S- |
| Molecular Weight | 415.01 g/mol |
| Exact Mass | 414.84 |
| IUPAC Name | (2,4-diiodocyclohexyl) sulfite |
| SMILES | O=S([O-])OC1CCC(I)CC1I |
| InChI | InChI=1S/C6H10I2O3S/c7-4-1-2-6(5(8)3-4)11-12(9)10/h4-6H,1-3H2,(H,9,10)/p-1 |
| InChIKey | HKNCLSSEYACZQF-UHFFFAOYSA-M |
| XLogP | 1.96 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.01 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|