C11H17NO3 — CID 91806185
[3-(prop-2-enylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 91806185) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is [3-(prop-2-enylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [3-(prop-2-enylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 91806185 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | [3-(prop-2-enylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | C=CCNC1C=CC(COC(C)=O)OC1 |
| InChI | InChI=1S/C11H17NO3/c1-3-6-12-10-4-5-11(15-7-10)8-14-9(2)13/h3-5,10-12H,1,6-8H2,2H3 |
| InChIKey | HRVLPSFRUBQWLN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|