C25H22FNO4S — CID 91808453
5-(4-fluoro-2-methoxyphenyl)-4-(2-methylpropanoyl)-1-(4-thiophen-3-ylphenyl)pyrrolidine-2,3-dione (PubChem CID 91808453) has the molecular formula C25H22FNO4S and a molecular weight of 451.52 g/mol. Its IUPAC name is 5-(4-fluoro-2-methoxyphenyl)-4-(2-methylpropanoyl)-1-(4-thiophen-3-ylphenyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(4-fluoro-2-methoxyphenyl)-4-(2-methylpropanoyl)-1-(4-thiophen-3-ylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808453 |
| Molecular Formula | C25H22FNO4S |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 5-(4-fluoro-2-methoxyphenyl)-4-(2-methylpropanoyl)-1-(4-thiophen-3-ylphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(F)ccc1C1C(C(=O)C(C)C)C(=O)C(=O)N1c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C25H22FNO4S/c1-14(2)23(28)21-22(19-9-6-17(26)12-20(19)31-3)27(25(30)24(21)29)18-7-4-15(5-8-18)16-10-11-32-13-16/h4-14,21-22H,1-3H3 |
| InChIKey | GIWSWILVYLQLQK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|