C21H15ClF4N2O3 — CID 91810182
methyl 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-[(2-hydroxyphenyl)methyl]amino]-3-fluorobenzoate (PubChem CID 91810182) has the molecular formula C21H15ClF4N2O3 and a molecular weight of 454.81 g/mol. Its IUPAC name is methyl 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-[(2-hydroxyphenyl)methyl]amino]-3-fluorobenzoate.
| Compound Name | methyl 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-[(2-hydroxyphenyl)methyl]amino]-3-fluorobenzoate |
|---|---|
| PubChem CID | 91810182 |
| Molecular Formula | C21H15ClF4N2O3 |
| Molecular Weight | 454.81 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | methyl 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-[(2-hydroxyphenyl)methyl]amino]-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(N(Cc2ccccc2O)c2ncc(C(F)(F)F)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C21H15ClF4N2O3/c1-31-20(30)12-6-7-17(16(23)8-12)28(11-13-4-2-3-5-18(13)29)19-15(22)9-14(10-27-19)21(24,25)26/h2-10,29H,11H2,1H3 |
| InChIKey | NKLDHOHYVGNCES-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.81 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|