C18H17N3O3 — CID 91814380
2-(1,3-benzodioxol-5-yl)-1-(4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)ethanone (PubChem CID 91814380) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-(4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)ethanone.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-(4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)ethanone |
|---|---|
| PubChem CID | 91814380 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-(4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)ethanone |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N1C2CCC1c1cncnc1C2 |
| InChI | InChI=1S/C18H17N3O3/c22-18(6-11-1-4-16-17(5-11)24-10-23-16)21-12-2-3-15(21)13-8-19-9-20-14(13)7-12/h1,4-5,8-9,12,15H,2-3,6-7,10H2 |
| InChIKey | JVPVMCPGZZSDDC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |