C12H9NO4 — CID 168896066
2-(1,3-benzodioxol-5-yl)-1-(1,3-oxazol-5-yl)ethanone (PubChem CID 168896066) has the molecular formula C12H9NO4 and a molecular weight of 231.21 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-(1,3-oxazol-5-yl)ethanone.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-(1,3-oxazol-5-yl)ethanone |
|---|---|
| PubChem CID | 168896066 |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-(1,3-oxazol-5-yl)ethanone |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)c1cnco1 |
| InChI | InChI=1S/C12H9NO4/c14-9(12-5-13-6-15-12)3-8-1-2-10-11(4-8)17-7-16-10/h1-2,4-6H,3,7H2 |
| InChIKey | MFWDBDSSCOZCHY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |