C19H14N4O6 — CID 91818692
8-methoxy-2-oxo-N-[[3-(2-oxo-1H-pyridin-4-yl)-1,2,4-oxadiazol-5-yl]methyl]chromene-3-carboxamide (PubChem CID 91818692) has the molecular formula C19H14N4O6 and a molecular weight of 394.34 g/mol. Its IUPAC name is 8-methoxy-2-oxo-N-[[3-(2-oxo-1H-pyridin-4-yl)-1,2,4-oxadiazol-5-yl]methyl]chromene-3-carboxamide.
| Compound Name | 8-methoxy-2-oxo-N-[[3-(2-oxo-1H-pyridin-4-yl)-1,2,4-oxadiazol-5-yl]methyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 91818692 |
| Molecular Formula | C19H14N4O6 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 8-methoxy-2-oxo-N-[[3-(2-oxo-1H-pyridin-4-yl)-1,2,4-oxadiazol-5-yl]methyl]chromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NCc3nc(-c4cc[nH]c(=O)c4)no3)c(=O)oc12 |
| InChI | InChI=1S/C19H14N4O6/c1-27-13-4-2-3-10-7-12(19(26)28-16(10)13)18(25)21-9-15-22-17(23-29-15)11-5-6-20-14(24)8-11/h2-8H,9H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | SWEPZIAQANCKHG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|