C16H12F2N4O3 — CID 91819276
(Z)-3-(2,5-difluorophenyl)-N-[[3-(5-methyl-1,2-oxazol-3-yl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enamide (PubChem CID 91819276) has the molecular formula C16H12F2N4O3 and a molecular weight of 346.29 g/mol. Its IUPAC name is (Z)-3-(2,5-difluorophenyl)-N-[[3-(5-methyl-1,2-oxazol-3-yl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enamide.
| Compound Name | (Z)-3-(2,5-difluorophenyl)-N-[[3-(5-methyl-1,2-oxazol-3-yl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 91819276 |
| Molecular Formula | C16H12F2N4O3 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (Z)-3-(2,5-difluorophenyl)-N-[[3-(5-methyl-1,2-oxazol-3-yl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enamide |
| SMILES | Cc1cc(-c2noc(CNC(=O)/C=C\c3cc(F)ccc3F)n2)no1 |
| InChI | InChI=1S/C16H12F2N4O3/c1-9-6-13(21-24-9)16-20-15(25-22-16)8-19-14(23)5-2-10-7-11(17)3-4-12(10)18/h2-7H,8H2,1H3,(H,19,23)/b5-2- |
| InChIKey | VGUXNKLHBXSTCE-DJWKRKHSSA-N |
| XLogP | 2.64 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|