C20H19BrN4O3 — CID 91819450
1-[1-(5-bromopyridine-3-carbonyl)piperidin-4-yl]-3-phenylimidazolidine-2,4-dione (PubChem CID 91819450) has the molecular formula C20H19BrN4O3 and a molecular weight of 443.30 g/mol. Its IUPAC name is 1-[1-(5-bromopyridine-3-carbonyl)piperidin-4-yl]-3-phenylimidazolidine-2,4-dione.
| Compound Name | 1-[1-(5-bromopyridine-3-carbonyl)piperidin-4-yl]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91819450 |
| Molecular Formula | C20H19BrN4O3 |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 1-[1-(5-bromopyridine-3-carbonyl)piperidin-4-yl]-3-phenylimidazolidine-2,4-dione |
| SMILES | O=C(c1cncc(Br)c1)N1CCC(N2CC(=O)N(c3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C20H19BrN4O3/c21-15-10-14(11-22-12-15)19(27)23-8-6-16(7-9-23)24-13-18(26)25(20(24)28)17-4-2-1-3-5-17/h1-5,10-12,16H,6-9,13H2 |
| InChIKey | BRHGZSMIVOCUTE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|