C25H26N4O3 — CID 91819445
1-[1-[2-(1-methylindol-3-yl)acetyl]piperidin-4-yl]-3-phenylimidazolidine-2,4-dione (PubChem CID 91819445) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-[1-[2-(1-methylindol-3-yl)acetyl]piperidin-4-yl]-3-phenylimidazolidine-2,4-dione.
| Compound Name | 1-[1-[2-(1-methylindol-3-yl)acetyl]piperidin-4-yl]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91819445 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-[1-[2-(1-methylindol-3-yl)acetyl]piperidin-4-yl]-3-phenylimidazolidine-2,4-dione |
| SMILES | Cn1cc(CC(=O)N2CCC(N3CC(=O)N(c4ccccc4)C3=O)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H26N4O3/c1-26-16-18(21-9-5-6-10-22(21)26)15-23(30)27-13-11-19(12-14-27)28-17-24(31)29(25(28)32)20-7-3-2-4-8-20/h2-10,16,19H,11-15,17H2,1H3 |
| InChIKey | YPEFFTFXALKZJT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 65.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|