C16H18ClN3O3 — CID 139306179
1-[1-(2-chloroacetyl)piperidin-4-yl]-3-phenylimidazolidine-2,4-dione (PubChem CID 139306179) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 1-[1-(2-chloroacetyl)piperidin-4-yl]-3-phenylimidazolidine-2,4-dione.
| Compound Name | 1-[1-(2-chloroacetyl)piperidin-4-yl]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139306179 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-[1-(2-chloroacetyl)piperidin-4-yl]-3-phenylimidazolidine-2,4-dione |
| SMILES | O=C(CCl)N1CCC(N2CC(=O)N(c3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C16H18ClN3O3/c17-10-14(21)18-8-6-12(7-9-18)19-11-15(22)20(16(19)23)13-4-2-1-3-5-13/h1-5,12H,6-11H2 |
| InChIKey | VCGTTWVSLMHROE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|