C10H20S2 — CID 91826876
(1S,2S,5R)-2-methyl-5-[(2R)-1-sulfanylpropan-2-yl]cyclohexane-1-thiol (PubChem CID 91826876) has the molecular formula C10H20S2 and a molecular weight of 204.40 g/mol. Its IUPAC name is (1S,2S,5R)-2-methyl-5-[(2R)-1-sulfanylpropan-2-yl]cyclohexane-1-thiol.
| Compound Name | (1S,2S,5R)-2-methyl-5-[(2R)-1-sulfanylpropan-2-yl]cyclohexane-1-thiol |
|---|---|
| PubChem CID | 91826876 |
| Molecular Formula | C10H20S2 |
| Molecular Weight | 204.40 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (1S,2S,5R)-2-methyl-5-[(2R)-1-sulfanylpropan-2-yl]cyclohexane-1-thiol |
| SMILES | C[C@@H](CS)[C@@H]1CC[C@H](C)[C@@H](S)C1 |
| InChI | InChI=1S/C10H20S2/c1-7-3-4-9(5-10(7)12)8(2)6-11/h7-12H,3-6H2,1-2H3/t7-,8-,9+,10-/m0/s1 |
| InChIKey | SUNXFMPZAFGPFW-QEYWKRMJSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|