C15H22N4OS — CID 91840007
3-(2-methylimidazol-1-yl)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]butanamide (PubChem CID 91840007) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is 3-(2-methylimidazol-1-yl)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]butanamide.
| Compound Name | 3-(2-methylimidazol-1-yl)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]butanamide |
|---|---|
| PubChem CID | 91840007 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 3-(2-methylimidazol-1-yl)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]butanamide |
| SMILES | Cc1csc(CCCNC(=O)CC(C)n2ccnc2C)n1 |
| InChI | InChI=1S/C15H22N4OS/c1-11-10-21-15(18-11)5-4-6-17-14(20)9-12(2)19-8-7-16-13(19)3/h7-8,10,12H,4-6,9H2,1-3H3,(H,17,20) |
| InChIKey | CUJUSSTZKOBLOL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|