C11H19N3O3S2 — CID 98314597
(2R)-2-(methanesulfonamido)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]propanamide (PubChem CID 98314597) has the molecular formula C11H19N3O3S2 and a molecular weight of 305.43 g/mol. Its IUPAC name is (2R)-2-(methanesulfonamido)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]propanamide.
| Compound Name | (2R)-2-(methanesulfonamido)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]propanamide |
|---|---|
| PubChem CID | 98314597 |
| Molecular Formula | C11H19N3O3S2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (2R)-2-(methanesulfonamido)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]propanamide |
| SMILES | Cc1csc(CCCNC(=O)[C@@H](C)NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C11H19N3O3S2/c1-8-7-18-10(13-8)5-4-6-12-11(15)9(2)14-19(3,16)17/h7,9,14H,4-6H2,1-3H3,(H,12,15)/t9-/m1/s1 |
| InChIKey | DYFCUANBDJDXJB-SECBINFHSA-N |
| XLogP | 0.44 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|