C14H15N5O3 — CID 9185010
N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 9185010) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 9185010 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CN1CC(=O)N(CC(=O)NCc2cn3ccccc3n2)C1=O |
| InChI | InChI=1S/C14H15N5O3/c1-17-9-13(21)19(14(17)22)8-12(20)15-6-10-7-18-5-3-2-4-11(18)16-10/h2-5,7H,6,8-9H2,1H3,(H,15,20) |
| InChIKey | PMLDONZJAHOGGM-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|