C31H32N12O13 — CID 91866109
(2R)-2-[[(4R)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxybutanoyl]amino]-6-(2,4,6-trinitroanilino)hexanoic acid (PubChem CID 91866109) has the molecular formula C31H32N12O13 and a molecular weight of 780.67 g/mol. Its IUPAC name is (2R)-2-[[(4R)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxybutanoyl]amino]-6-(2,4,6-trinitroanilino)hexanoic acid.
| Compound Name | (2R)-2-[[(4R)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxybutanoyl]amino]-6-(2,4,6-trinitroanilino)hexanoic acid |
|---|---|
| PubChem CID | 91866109 |
| Molecular Formula | C31H32N12O13 |
| Molecular Weight | 780.67 g/mol |
| Exact Mass | 780.22 |
| IUPAC Name | (2R)-2-[[(4R)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxybutanoyl]amino]-6-(2,4,6-trinitroanilino)hexanoic acid |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)N[C@H](CCC(=O)N[C@H](CCCCNc4c([N+](=O)[O-])cc([N+](=O)[O-])cc4[N+](=O)[O-])C(=O)O)C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C31H32N12O13/c32-31-39-26-25(28(46)40-31)36-17(14-35-26)13-34-16-6-4-15(5-7-16)27(45)38-20(30(49)50)8-9-23(44)37-19(29(47)48)3-1-2-10-33-24-21(42(53)54)11-18(41(51)52)12-22(24)43(55)56/h4-7,11-12,14,19-20,33-34H,1-3,8-10,13H2,(H,37,44)(H,38,45)(H,47,48)(H,49,50)(H3,32,35,39,40,46)/t19-,20-/m1/s1 |
| InChIKey | XZHYJEKRZHQNPZ-WOJBJXKFSA-N |
| XLogP | 1.45 |
| TPSA | 383.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.67 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|