C31H42O6S — CID 91895585
3-[2-tert-butyl-4-(2-hydroxyethoxy)-5-methylphenyl]sulfanyl-6-[2-(4-hydroxyphenyl)ethyl]-6-pentyloxane-2,4-dione (PubChem CID 91895585) has the molecular formula C31H42O6S and a molecular weight of 542.74 g/mol. Its IUPAC name is 3-[2-tert-butyl-4-(2-hydroxyethoxy)-5-methylphenyl]sulfanyl-6-[2-(4-hydroxyphenyl)ethyl]-6-pentyloxane-2,4-dione.
| Compound Name | 3-[2-tert-butyl-4-(2-hydroxyethoxy)-5-methylphenyl]sulfanyl-6-[2-(4-hydroxyphenyl)ethyl]-6-pentyloxane-2,4-dione |
|---|---|
| PubChem CID | 91895585 |
| Molecular Formula | C31H42O6S |
| Molecular Weight | 542.74 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 3-[2-tert-butyl-4-(2-hydroxyethoxy)-5-methylphenyl]sulfanyl-6-[2-(4-hydroxyphenyl)ethyl]-6-pentyloxane-2,4-dione |
| SMILES | CCCCCC1(CCc2ccc(O)cc2)CC(=O)C(Sc2cc(C)c(OCCO)cc2C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C31H42O6S/c1-6-7-8-14-31(15-13-22-9-11-23(33)12-10-22)20-25(34)28(29(35)37-31)38-27-18-21(2)26(36-17-16-32)19-24(27)30(3,4)5/h9-12,18-19,28,32-33H,6-8,13-17,20H2,1-5H3 |
| InChIKey | ATCMWKZVYSEIBM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.74 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|