C15H17N3O3 — CID 91897411
1-morpholin-4-yl-2-[3-(nitrosomethyl)indol-1-yl]ethanone (PubChem CID 91897411) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-[3-(nitrosomethyl)indol-1-yl]ethanone.
| Compound Name | 1-morpholin-4-yl-2-[3-(nitrosomethyl)indol-1-yl]ethanone |
|---|---|
| PubChem CID | 91897411 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-morpholin-4-yl-2-[3-(nitrosomethyl)indol-1-yl]ethanone |
| SMILES | O=NCc1cn(CC(=O)N2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C15H17N3O3/c19-15(17-5-7-21-8-6-17)11-18-10-12(9-16-20)13-3-1-2-4-14(13)18/h1-4,10H,5-9,11H2 |
| InChIKey | YRKUARKLWOWCNZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |