C23H32N4O2 — CID 110211306
2-[3-[[(3R)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]indol-1-yl]-1-morpholin-4-ylethanone (PubChem CID 110211306) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 2-[3-[[(3R)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]indol-1-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[3-[[(3R)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]indol-1-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 110211306 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 2-[3-[[(3R)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]indol-1-yl]-1-morpholin-4-ylethanone |
| SMILES | C[C@@H]1CN2CCCC2CN1Cc1cn(CC(=O)N2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C23H32N4O2/c1-18-13-25-8-4-5-20(25)16-26(18)14-19-15-27(22-7-3-2-6-21(19)22)17-23(28)24-9-11-29-12-10-24/h2-3,6-7,15,18,20H,4-5,8-14,16-17H2,1H3/t18-,20?/m1/s1 |
| InChIKey | KIXRXXWPRLXBLQ-QSVWIEALSA-N |
| XLogP | 2.17 |
| TPSA | 40.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |