C22H32N4O — CID 92603831
2-[3-[[(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]indol-1-yl]-N-propan-2-ylacetamide (PubChem CID 92603831) has the molecular formula C22H32N4O and a molecular weight of 368.53 g/mol. Its IUPAC name is 2-[3-[[(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]indol-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[3-[[(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]indol-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 92603831 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 2-[3-[[(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]indol-1-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)Cn1cc(CN2C[C@@H]3CCCN3C[C@H]2C)c2ccccc21 |
| InChI | InChI=1S/C22H32N4O/c1-16(2)23-22(27)15-26-13-18(20-8-4-5-9-21(20)26)12-25-14-19-7-6-10-24(19)11-17(25)3/h4-5,8-9,13,16-17,19H,6-7,10-12,14-15H2,1-3H3,(H,23,27)/t17-,19+/m1/s1 |
| InChIKey | VDFIJZOCEDMUQB-MJGOQNOKSA-N |
| XLogP | 2.83 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |