C24H34N4O2 — CID 46960332
2-[3-[[(3S)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 46960332) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-[3-[[(3S)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[[(3S)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 46960332 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 2-[3-[[(3S)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | C[C@H]1CN2CCCC2CN1Cc1cn(CC(=O)NCC2CCCO2)c2ccccc12 |
| InChI | InChI=1S/C24H34N4O2/c1-18-13-26-10-4-6-20(26)16-27(18)14-19-15-28(23-9-3-2-8-22(19)23)17-24(29)25-12-21-7-5-11-30-21/h2-3,8-9,15,18,20-21H,4-7,10-14,16-17H2,1H3,(H,25,29)/t18-,20?,21?/m0/s1 |
| InChIKey | ZTQDARNKWLARFX-PELRDEGISA-N |
| XLogP | 2.61 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |