C13H21N4O2+ — CID 91898320
trimethyl-[3-[[6-(nitrosomethyl)pyridine-3-carbonyl]amino]propyl]azanium (PubChem CID 91898320) has the molecular formula C13H21N4O2+ and a molecular weight of 265.34 g/mol. Its IUPAC name is trimethyl-[3-[[6-(nitrosomethyl)pyridine-3-carbonyl]amino]propyl]azanium.
| Compound Name | trimethyl-[3-[[6-(nitrosomethyl)pyridine-3-carbonyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 91898320 |
| Molecular Formula | C13H21N4O2+ |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | trimethyl-[3-[[6-(nitrosomethyl)pyridine-3-carbonyl]amino]propyl]azanium |
| SMILES | C[N+](C)(C)CCCNC(=O)c1ccc(CN=O)nc1 |
| InChI | InChI=1S/C13H20N4O2/c1-17(2,3)8-4-7-14-13(18)11-5-6-12(10-16-19)15-9-11/h5-6,9H,4,7-8,10H2,1-3H3/p+1 |
| InChIKey | BYRSYXOAIKWALX-UHFFFAOYSA-O |
| XLogP | 1.17 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|