C18H16ClN3O4 — CID 91898509
1-[4-[(4-chlorophenyl)methylamino]-3-nitrophenyl]-3-methylpyrrole-2,5-diol (PubChem CID 91898509) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)methylamino]-3-nitrophenyl]-3-methylpyrrole-2,5-diol.
| Compound Name | 1-[4-[(4-chlorophenyl)methylamino]-3-nitrophenyl]-3-methylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91898509 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)methylamino]-3-nitrophenyl]-3-methylpyrrole-2,5-diol |
| SMILES | Cc1cc(O)n(-c2ccc(NCc3ccc(Cl)cc3)c([N+](=O)[O-])c2)c1O |
| InChI | InChI=1S/C18H16ClN3O4/c1-11-8-17(23)21(18(11)24)14-6-7-15(16(9-14)22(25)26)20-10-12-2-4-13(19)5-3-12/h2-9,20,23-24H,10H2,1H3 |
| InChIKey | DVKRIRMDNXYYMV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 100.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|