C17H10F3NO3 — CID 91900847
2-oxo-6-[3-(trifluoromethyl)phenyl]-1H-quinoline-3-carboxylic acid (PubChem CID 91900847) has the molecular formula C17H10F3NO3 and a molecular weight of 333.27 g/mol. Its IUPAC name is 2-oxo-6-[3-(trifluoromethyl)phenyl]-1H-quinoline-3-carboxylic acid.
| Compound Name | 2-oxo-6-[3-(trifluoromethyl)phenyl]-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 91900847 |
| Molecular Formula | C17H10F3NO3 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 2-oxo-6-[3-(trifluoromethyl)phenyl]-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(-c3cccc(C(F)(F)F)c3)ccc2[nH]c1=O |
| InChI | InChI=1S/C17H10F3NO3/c18-17(19,20)12-3-1-2-9(7-12)10-4-5-14-11(6-10)8-13(16(23)24)15(22)21-14/h1-8H,(H,21,22)(H,23,24) |
| InChIKey | RETWPBUQKFZQNX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |