C21H26N4O5 — CID 91903965
ethyl 4-[[2-(4-ethyl-2-morpholin-4-yl-6-oxopyrimidin-1-yl)acetyl]amino]benzoate (PubChem CID 91903965) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is ethyl 4-[[2-(4-ethyl-2-morpholin-4-yl-6-oxopyrimidin-1-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(4-ethyl-2-morpholin-4-yl-6-oxopyrimidin-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 91903965 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | ethyl 4-[[2-(4-ethyl-2-morpholin-4-yl-6-oxopyrimidin-1-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c(N3CCOCC3)nc(CC)cc2=O)cc1 |
| InChI | InChI=1S/C21H26N4O5/c1-3-16-13-19(27)25(21(23-16)24-9-11-29-12-10-24)14-18(26)22-17-7-5-15(6-8-17)20(28)30-4-2/h5-8,13H,3-4,9-12,14H2,1-2H3,(H,22,26) |
| InChIKey | VZJLUNYCDHISOY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |