C20H22N2O4S2 — CID 91906050
(3aS,6aR)-2-(2-methylphenyl)sulfonyl-5-(1-thiophen-2-ylpropyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 91906050) has the molecular formula C20H22N2O4S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is (3aS,6aR)-2-(2-methylphenyl)sulfonyl-5-(1-thiophen-2-ylpropyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3aS,6aR)-2-(2-methylphenyl)sulfonyl-5-(1-thiophen-2-ylpropyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 91906050 |
| Molecular Formula | C20H22N2O4S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | (3aS,6aR)-2-(2-methylphenyl)sulfonyl-5-(1-thiophen-2-ylpropyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | CCC(c1cccs1)N1C(=O)[C@H]2CN(S(=O)(=O)c3ccccc3C)C[C@H]2C1=O |
| InChI | InChI=1S/C20H22N2O4S2/c1-3-16(17-8-6-10-27-17)22-19(23)14-11-21(12-15(14)20(22)24)28(25,26)18-9-5-4-7-13(18)2/h4-10,14-16H,3,11-12H2,1-2H3/t14-,15+,16? |
| InChIKey | FRDMXDSKPODSDT-XYPWUTKMSA-N |
| XLogP | 2.81 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|