C20H21FN2O4S2 — CID 91916108
(3aR,6aS)-2-[(2-fluorophenyl)methylsulfonyl]-5-(1-thiophen-2-ylpropyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 91916108) has the molecular formula C20H21FN2O4S2 and a molecular weight of 436.53 g/mol. Its IUPAC name is (3aR,6aS)-2-[(2-fluorophenyl)methylsulfonyl]-5-(1-thiophen-2-ylpropyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3aR,6aS)-2-[(2-fluorophenyl)methylsulfonyl]-5-(1-thiophen-2-ylpropyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 91916108 |
| Molecular Formula | C20H21FN2O4S2 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | (3aR,6aS)-2-[(2-fluorophenyl)methylsulfonyl]-5-(1-thiophen-2-ylpropyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | CCC(c1cccs1)N1C(=O)[C@H]2CN(S(=O)(=O)Cc3ccccc3F)C[C@H]2C1=O |
| InChI | InChI=1S/C20H21FN2O4S2/c1-2-17(18-8-5-9-28-18)23-19(24)14-10-22(11-15(14)20(23)25)29(26,27)12-13-6-3-4-7-16(13)21/h3-9,14-15,17H,2,10-12H2,1H3/t14-,15+,17? |
| InChIKey | DETZPACLZIVEIE-FKEKPDDDSA-N |
| XLogP | 2.79 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|