C23H24N4O4 — CID 91908443
2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-7-[(2,5-dimethylphenyl)methyl]-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-3,8-dione (PubChem CID 91908443) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-7-[(2,5-dimethylphenyl)methyl]-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-3,8-dione.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-7-[(2,5-dimethylphenyl)methyl]-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-3,8-dione |
|---|---|
| PubChem CID | 91908443 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-7-[(2,5-dimethylphenyl)methyl]-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-3,8-dione |
| SMILES | Cc1ccc(C)c(CN2CCn3c(nn(CC4COc5ccccc5O4)c3=O)C2=O)c1 |
| InChI | InChI=1S/C23H24N4O4/c1-15-7-8-16(2)17(11-15)12-25-9-10-26-21(22(25)28)24-27(23(26)29)13-18-14-30-19-5-3-4-6-20(19)31-18/h3-8,11,18H,9-10,12-14H2,1-2H3 |
| InChIKey | UYBVXHILYGYYPZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |