C21H23BrN4O2 — CID 91908779
N-[(3-bromophenyl)methyl]-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-4-yl)acetamide (PubChem CID 91908779) has the molecular formula C21H23BrN4O2 and a molecular weight of 443.35 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-4-yl)acetamide.
| Compound Name | N-[(3-bromophenyl)methyl]-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-4-yl)acetamide |
|---|---|
| PubChem CID | 91908779 |
| Molecular Formula | C21H23BrN4O2 |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-4-yl)acetamide |
| SMILES | Cc1cc2nc3n(c(=O)c2n1CC(=O)NCc1cccc(Br)c1)CCCCC3 |
| InChI | InChI=1S/C21H23BrN4O2/c1-14-10-17-20(21(28)25-9-4-2-3-8-18(25)24-17)26(14)13-19(27)23-12-15-6-5-7-16(22)11-15/h5-7,10-11H,2-4,8-9,12-13H2,1H3,(H,23,27) |
| InChIKey | BQSXEUVOBFQDPM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |